Introduction:Basic information about CAS 6307-83-1|3-Bromo-5-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromo-5-nitrobenzoic acid |
|---|
| CAS Number | 6307-83-1 | Molecular Weight | 246.015 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 376.8±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4BrNO4 | Melting Point | 159-161°C |
|---|
| MSDS | / | Flash Point | 181.7±25.1 °C |
|---|
Names
| Name | 3-Bromo-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 376.8±32.0 °C at 760 mmHg |
|---|
| Melting Point | 159-161°C |
|---|
| Molecular Formula | C7H4BrNO4 |
|---|
| Molecular Weight | 246.015 |
|---|
| Flash Point | 181.7±25.1 °C |
|---|
| Exact Mass | 244.932358 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.44 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | AXRKIZCFYZBBPX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Br)cc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| WNR CE EVQ |
| 3-nitro-5-bromobenzoic acid |
| 3-Bromo-5-nitrobenzoic acid |
| MFCD00100098 |
| Benzoic acid, 3-bromo-5-nitro- |
| 5-bromo-3-nitrobenzoic acid |
| Benzoic acid,3-bromo-5-nitro |
| 3-Brom-5-nitro-benzoesaeure |
| 3-bromo-5-nitro benzoic acid |