Introduction:Basic information about CAS 929379-35-1|6-Bromo-2-(trifluoromethyl)quinazolin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Bromo-2-(trifluoromethyl)quinazolin-4-amine |
|---|
| CAS Number | 929379-35-1 | Molecular Weight | 292.05500 |
|---|
| Density | 1.803g/cm3 | Boiling Point | 254.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5BrF3N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 108ºC |
|---|
Names
| Name | 6-Bromo-2-(trifluoromethyl)quinazolin-4-amine |
|---|
Chemical & Physical Properties
| Density | 1.803g/cm3 |
|---|
| Boiling Point | 254.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5BrF3N3 |
|---|
| Molecular Weight | 292.05500 |
|---|
| Flash Point | 108ºC |
|---|
| Exact Mass | 290.96200 |
|---|
| PSA | 51.80000 |
|---|
| LogP | 3.57450 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | JULKCZSSDBZSAG-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(C(F)(F)F)nc2ccc(Br)cc12 |
|---|