Introduction:Basic information about CAS 4722-94-5|4-Chloro-2,6-pyridinedicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-2,6-pyridinedicarboxylic acid |
|---|
| CAS Number | 4722-94-5 | Molecular Weight | 201.56400 |
|---|
| Density | 1.684g/cm3 | Boiling Point | 457.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClNO4 | Melting Point | 210ºC |
|---|
| MSDS | / | Flash Point | 230.2ºC |
|---|
Names
| Name | 4-Chloropyridine-2,6-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.684g/cm3 |
|---|
| Boiling Point | 457.1ºC at 760mmHg |
|---|
| Melting Point | 210ºC |
|---|
| Molecular Formula | C7H4ClNO4 |
|---|
| Molecular Weight | 201.56400 |
|---|
| Flash Point | 230.2ºC |
|---|
| Exact Mass | 200.98300 |
|---|
| PSA | 87.49000 |
|---|
| LogP | 1.13140 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | IYUMNONNHYADBU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Cl)cc(C(=O)O)n1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 20/21/22 |
|---|
| Safety Phrases | 36/37 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Chloro-2,6-pyridinedicarboxylic acid |
| 4-CHLORO-PYRIDINE-2,6-DICARBOXYLIC ACID |
| chloropyridinedicarboxylicacid |
| 4-chloro-2,6-pyridinecarboxylic acid |
| 4-Chlor-2,6-pyridindicarbonsaeure |
| 4-chlorodipicolinic acid |
| 4-Chloro-2,6-pyridinedicarboxylic Acid |
| 4-Chloro-pyridine-2,6-dicarboxylic |