CAS 78092-53-2|4-tert-Butylcalix[6]arene
Introduction：Basic information about CAS 78092-53-2|4-tert-Butylcalix[6]arene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butylcalix[6]arene | ||
|---|---|---|---|
| CAS Number | 78092-53-2 | Molecular Weight | 973.370 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 890.5±65.0 °C at 760 mmHg |
| Molecular Formula | C66H84O6 | Melting Point | 300ºC |
| MSDS | / | Flash Point | 281.3±28.9 °C |
Names
| Name | Hexa-Tert-Butyl(Hexahydroxy)Calix[6]Arene |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 890.5±65.0 °C at 760 mmHg |
| Melting Point | 300ºC |
| Molecular Formula | C66H84O6 |
| Molecular Weight | 973.370 |
| Flash Point | 281.3±28.9 °C |
| Exact Mass | 972.626770 |
| PSA | 121.38000 |
| LogP | 18.19 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | UOEYZAXKBKAKRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| Storage condition | Store below +30°C. |
Safety Information
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29072990 |
Synonyms
| 5,11,17,23,29,35-Hexakis(2-methyl-2-propanyl)heptacyclo[31.3.1.1.1.1.1.1]dotetraconta-1(37),3(42),4,6,9(41),10,12,15(40),16,18,21(39),22,24,27(38),28,30,33,35-octadecae ne-37,38,39,40,41,42-hexol |
| heptacyclo[31.3.1.1.1.1.1.1]dotetraconta-1(37),3,5,7(42),9,11,13(41),15,17,19(40),21,23,25(39),27,29,31(38),33,35-octadecaene-37,38,39,40,41,42-hexol, 5,11,17,23,29,35-hexakis(1,1-dimethylethyl)- |
| Heptacyclo[31.3.1.1.1.1.1.1]dotetraconta-1(37),3,5,7(42),9,11,13(41),15,17,19(40),21,23,25(39),27,29,31(38),33,35-octadecaene-37,38,39,40,41,42-hexol, 5,11,17,23,29,35- hexakis(1,1-dimethylethyl)- |
| MFCD00075464 |
| 4-tert-Butylcalix[6]arene |
| 5,11,17,23,29,35-Hexa-tert-butylheptacyclo[31.3.1.1.1.1.1.1]dotetraconta-1(37),3(42),4,6,9(41),10,12,15(40),16,18,21(39),22,24,27(38),28,30,33,35-octadecaene-37,38,39,40,41,42-hexol |
