Introduction：Basic information about CAS 18733-91-0|bis(4-bromophenyl)-diphenyl-silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(4-bromophenyl)-diphenyl-silane |
|---|
| CAS Number | 18733-91-0 | Molecular Weight | 494.29300 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 494.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H18Br2Si | Melting Point | 169 °C |
|---|
| MSDS | / | Flash Point | 390.5ºC |
|---|
Names
| Name | bis(4-bromophenyl)-diphenylsilane |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 494.4ºC at 760 mmHg |
|---|
| Melting Point | 169 °C |
|---|
| Molecular Formula | C24H18Br2Si |
|---|
| Molecular Weight | 494.29300 |
|---|
| Flash Point | 390.5ºC |
|---|
| Exact Mass | 491.95400 |
|---|
| LogP | 4.58900 |
|---|
| Vapour Pressure | 1.97E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.68 |
|---|
| InChIKey | UTEBJTKMYMQRIF-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(Br)cc2)cc1 |
|---|
