Introduction:Basic information about CAS 92224-44-7|3,4-diazabicyclo[4.3.0]non-10-ene-2,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-diazabicyclo[4.3.0]non-10-ene-2,5-dione |
|---|
| CAS Number | 92224-44-7 | Molecular Weight | 152.15100 |
|---|
| Density | 1.38g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5,6,7-tetrahydro-2H-cyclopenta[d]pyridazine-1,4-dione |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Molecular Formula | C7H8N2O2 |
|---|
| Molecular Weight | 152.15100 |
|---|
| Exact Mass | 152.05900 |
|---|
| PSA | 65.72000 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | HBKYKQJBXCNTFO-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH][nH]c(=O)c2c1CCC2 |
|---|