Introduction：Basic information about CAS 332064-94-5|fmoc-(r)-3-amino-5-hexynoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-(r)-3-amino-5-hexynoic acid |
|---|
| CAS Number | 332064-94-5 | Molecular Weight | 349.380 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 591.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H19NO4 | Melting Point | 152-153℃ |
|---|
| MSDS | / | Flash Point | 311.5±30.1 °C |
|---|
Names
| Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-ynoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 591.5±50.0 °C at 760 mmHg |
|---|
| Melting Point | 152-153℃ |
|---|
| Molecular Formula | C21H19NO4 |
|---|
| Molecular Weight | 349.380 |
|---|
| Flash Point | 311.5±30.1 °C |
|---|
| Exact Mass | 349.131409 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.19 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | ALHPEVGGGAQSCG-CQSZACIVSA-N |
|---|
| SMILES | C#CCC(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| Fmoc-(R)-3-Amino-5-hexynoic acid |
| 5-Hexynoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (3R)- |
| (3R)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-hexynoicacid |
| (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hex-5-ynoic acid |
| (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-hexynoic acid |
