Introduction：Basic information about CAS 188111-79-7|(R)-1-Boc-3-Aminopiperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-1-Boc-3-Aminopiperidine |
|---|
| CAS Number | 188111-79-7 | Molecular Weight | 200.278 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 277.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H20N2O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 121.5±25.4 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl (3R)-3-aminopiperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 277.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H20N2O2 |
|---|
| Molecular Weight | 200.278 |
|---|
| Flash Point | 121.5±25.4 °C |
|---|
| Exact Mass | 200.152481 |
|---|
| PSA | 55.56000 |
|---|
| LogP | 0.71 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.484 |
|---|
| InChIKey | AKQXKEBCONUWCL-MRVPVSSYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC(N)C1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN2735 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD04973125 |
| tert-Butyl-3-aminopiperidin-1-carboxylat |
| 1-BOC-3-aminopiperidine |
| 1-Piperidinecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester |
| (R)-tert-Butyl 3-aminopiperidine-1-carboxylate |
| (R)-1-BOC-3-Aminopiperidine |
| (R)-(-)-3-Amino-1-Boc-piperidine |
| (R)-(-)-1-Boc-3-aminopiperidine |
| 2-Methyl-2-propanyl 3-amino-1-piperidinecarboxylate |
| (R)-3-aminopiperidine-1-carboxylic acid tert-butyl ester |
| tert-butyl (3R)3-aminopiperidine-1-carboxylate |
| (R)-3-Amino-1-N-BOC-piperidine |
| tert-butyl 3-aminopiperidine-1-carboxylate |
