Introduction：Basic information about CAS 33965-47-8|4-Chloro-D-Phe-OMe·HCl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-D-Phe-OMe·HCl |
|---|
| CAS Number | 33965-47-8 | Molecular Weight | 250.122 |
|---|
| Density | / | Boiling Point | 330ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13Cl2NO2 | Melting Point | 195-197°C |
|---|
| MSDS | / | Flash Point | 153.4ºC |
|---|
Names
| Name | Methyl 4-chloro-D-phenylalaninate hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
4-Chloro-D-Phe-OMe·HCl BiologicalActivity
| Description | H-D-Phe(4-Cl)OMe.HCl is a phenylalanine derivative[1]. |
|---|
| Related Catalog | Research Areas >>OthersSignaling Pathways >>Others >>Others |
|---|
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
|---|
| References | [1]. Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-836. |
|---|
Chemical & Physical Properties
| Boiling Point | 330ºC at 760 mmHg |
|---|
| Melting Point | 195-197°C |
|---|
| Molecular Formula | C10H13Cl2NO2 |
|---|
| Molecular Weight | 250.122 |
|---|
| Flash Point | 153.4ºC |
|---|
| Exact Mass | 249.032333 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 2.88510 |
|---|
| InChIKey | GCBCWTWQAFLKJG-SBSPUUFOSA-N |
|---|
| SMILES | COC(=O)C(N)Cc1ccc(Cl)cc1.Cl |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Chloro-D-Phe-OMe&H-p-Chloro-D-Phe-OMe |
| 3-(4-Chlorophenyl)-1-methoxy-1-oxo-2-propanaminium chloride |
| H-D-Phe(4-Cl)-OMe.HCl |
| Benzeneethanaminium, 4-chloro-α-(methoxycarbonyl)-, chloride (1:1) |
| MFCD00236920 |
| DL-4-Chlorophenylalanine methyl ester hydrochloride |
| methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride |
| DL-p-Chlorophenylalanine methyl ester hydrochloride |
| 4-Chloro-D-phenylalanine methyl ester hydrochloride |
| 4-chorophenylalanine methyl ester hydrochloride |
| 4-Chloro-DL-Phe-OMe HCl |
| H-p-Chlooro-D-Phe-OMeHCl. |
| L-(4-Chlorphenyl)alanin-methylester-hydrochlorid |
| H-P-CHLORO-D-PHE-OME HCL |
| P-CHLORO-D-PHENYLALANINE-OME HCL |
| 4-CHLORO-D-PHE-OME HCL |
| p-chloro-L-phenylalanine methyl ester.HCl |
| (R)-Methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride |
| 4-Chloro-D-Phe-OMeMeCl] |
| 4-CHLORO-D-PHE-OMEHCLMIN |
| p-chlorophenylalanine methyl ester hydrochloride |
| UNII:OC0YKX1H41 |
| D,L-4-chlorophenylalanine methyl ester hydrochloride |
| 4-Chloro-D-Phe-OMe·HCl |
