Introduction：Basic information about CAS 79411-15-7|Echinocandin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Echinocandin B |
|---|
| CAS Number | 79411-15-7 | Molecular Weight | 797.807 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1330.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H51N7O15 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 758.6±34.3 °C |
|---|
Names
| Name | 9-Amino-23-[1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,12,15-tetrahydroxy-6,20-bis(1-hydroxyethyl)-16-methylhexadecahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosine-5,8,14,19,22,25(9H,25aH)-hexone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 1330.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H51N7O15 |
|---|
| Molecular Weight | 797.807 |
|---|
| Flash Point | 758.6±34.3 °C |
|---|
| Exact Mass | 797.344299 |
|---|
| PSA | 379.07000 |
|---|
| LogP | -10.63 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.690 |
|---|
| InChIKey | BLKJKIJFNJAQIZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)C1NC(=O)C(N)CC(O)C(O)NC(=O)C2C(O)C(C)CN2C(=O)C(C(C)O)NC(=O)C(C(O)C(O)c2ccc(O)cc2)NC(=O)C2CC(O)CN2C1=O |
|---|
Safety Information
Synonyms
| 9-Amino-23-[1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,12,15-tetrahydroxy-6,20-bis(1-hydroxyethyl)-16-methylhexadecahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosine-5,8,14,19,22,25(9H,25aH)-hexone |
| 1H-Dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacycloheneicosine-5,8,14,19,22,25(9H,25aH)-hexone, 9-amino-23-[1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]hexadecahydro-2,11,12,15-tetrahydroxy-6,20-bis(1-hydroxyethyl)-16-methyl- |
| Echinocandin B |
