Introduction：Basic information about CAS 924645-41-0|2-Methyl-1-[4-(2-pyrimidinyl)-1-piperazinyl]-2-propanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-1-[4-(2-pyrimidinyl)-1-piperazinyl]-2-propanamine |
|---|
| CAS Number | 924645-41-0 | Molecular Weight | 235.32900 |
|---|
| Density | 1.102g/cm3 | Boiling Point | 388ºC at 760 mmHg |
|---|
| Molecular Formula | C12H21N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.5ºC |
|---|
Names
| Name | 2-Methyl-1-[4-(2-pyrimidinyl)-1-piperazinyl]-2-propanamine |
|---|
Chemical & Physical Properties
| Density | 1.102g/cm3 |
|---|
| Boiling Point | 388ºC at 760 mmHg |
|---|
| Molecular Formula | C12H21N5 |
|---|
| Molecular Weight | 235.32900 |
|---|
| Flash Point | 188.5ºC |
|---|
| Exact Mass | 235.18000 |
|---|
| PSA | 58.28000 |
|---|
| LogP | 1.03910 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | WMWALLXBQOYCII-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(N)CN1CCN(c2ncccn2)CC1 |
|---|
