Introduction：Basic information about CAS 18056-97-8|4-Biphenylyl(triethoxy)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Biphenylyl(triethoxy)silane |
|---|
| CAS Number | 18056-97-8 | Molecular Weight | 316.467 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 359.1±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H24O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.5±29.5 °C |
|---|
Names
| Name | triethoxy-(4-phenylphenyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 359.1±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H24O3Si |
|---|
| Molecular Weight | 316.467 |
|---|
| Flash Point | 173.5±29.5 °C |
|---|
| Exact Mass | 316.149475 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 4.75 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | KMISPMRSLVRNRI-UHFFFAOYSA-N |
|---|
| SMILES | CCO[Si](OCC)(OCC)c1ccc(-c2ccccc2)cc1 |
|---|
Synonyms
| 1,1'-Biphenyl, 4-(triethoxysilyl)- |
| Triaethoxy-biphenyl-4-yl-silan |
| 4-Biphenylyl(triethoxy)silane |
| 1,1'-Biphenyl,4-(triethoxysilyl) |
| [4-(phenyl)phenyl]triethoxysilane |
| triethoxy-biphenyl-4-yl-silane |
| (4-biphenyl)triethoxysilane |
| (4-xe)Si(Oet)3 |
| 4-triethoxysilyl-1,1'-biphenyl |
| [1,1'-Biphenyl]-4-yltriethoxysilane |
