Introduction:Basic information about CAS 18292-14-3|5-Trimethylsilyl-2-furoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Trimethylsilyl-2-furoic acid |
|---|
| CAS Number | 18292-14-3 | Molecular Weight | 184.26500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H12O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-trimethylsilylfuran-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H12O3Si |
|---|
| Molecular Weight | 184.26500 |
|---|
| Exact Mass | 184.05600 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 1.52300 |
|---|
| InChIKey | UZPORAFHCXAETB-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)c1ccc(C(=O)O)o1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-Furancarboxylicacid,5-(trimethylsilyl) |
| 5-TMS-furan-2-carboxylic acid |
| 5-trimethylsilanyl-furan-2-carboxylic acid |
| 5-Trimethylsilyl-furan-2-carbonsaeure |
| 5-(trimethylsilyl)furan-2-carboxylic acid |
| 5-trimethylsilyl-2-furancarboxylic acid |