Introduction：Basic information about CAS 713512-18-6|1-Bromo-4-iodo-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-4-iodo-2-nitrobenzene |
|---|
| CAS Number | 713512-18-6 | Molecular Weight | 327.902 |
|---|
| Density | 2.3±0.1 g/cm3 | Boiling Point | 296.8±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3BrINO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.3±21.8 °C |
|---|
Names
| Name | 1-Bromo-4-iodo-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.3±0.1 g/cm3 |
|---|
| Boiling Point | 296.8±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3BrINO2 |
|---|
| Molecular Weight | 327.902 |
|---|
| Flash Point | 133.3±21.8 °C |
|---|
| Exact Mass | 326.839172 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.691 |
|---|
| InChIKey | JKIQXEOUGXCWLB-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(I)ccc1Br |
|---|
Synonyms
| Benzene, 1-bromo-4-iodo-2-nitro- |
| 1-Bromo-4-iodo-2-nitrobenzene |
| 1-bromo-4-iodo-2-nitro-benzene |
| 1-bromo-4-iodobicyclo<2.2.1>heptane |
| 1-Brom-4-jod-2-nitro-benzol |
| Bicyclo[2.2.1]heptane,1-bromo-4-iodo |
| 1-Brom-4-iodnorbornan |
