Introduction：Basic information about CAS 7195-44-0|bis(2,3-epoxypropyl) terephthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2,3-epoxypropyl) terephthalate |
|---|
| CAS Number | 7195-44-0 | Molecular Weight | 278.25700 |
|---|
| Density | 1.351g/cm3 | Boiling Point | 426.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.1ºC |
|---|
Names
| Name | Bis(2-oxiranylmethyl) terephthalate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.351g/cm3 |
|---|
| Boiling Point | 426.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O6 |
|---|
| Molecular Weight | 278.25700 |
|---|
| Flash Point | 191.1ºC |
|---|
| Exact Mass | 278.07900 |
|---|
| PSA | 77.66000 |
|---|
| LogP | 0.79780 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | NEPKLUNSRVEBIX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)cc1 |
|---|
Synonyms
| Terephthalsaeure-diglycidylester |
| diglycidyl terephthalate |
| o-Phthalic acid diglycidyl ester |
| terephthalic acid diglycidyl ester |
| 1,2-diglycidyl phthalate |
| diglycidyl phthalate |
| Phthalic acid diglycidyl ester |
| diglycidyl orthophthalate |
| Ak-838 |
| phthalic acid bis-oxiranylmethyl ester |
| Terephthalsaeure-bis-<2,3-epoxy-propyl-ester> |
| terephthalic acid bis-oxiranylmethyl ester |
| Phthalsaeure-diglycidylester |
| bis(2,3-epoxypropyl) terephthalate |
| Diglycidylphthalat |
| Diglycidylester kyseliny ftalove |
| Phthalsaeure-bis-<2,3-epoxy-propyl-ester> |
| DIGLYCIDYLESTEROFPHTHALICACID |
