Introduction:Basic information about CAS 97963-76-3|4-Difluoromethoxy-2-Nitro-Aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Difluoromethoxy-2-Nitro-Aniline |
|---|
| CAS Number | 97963-76-3 | Molecular Weight | 204.131 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 330.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6F2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.4±26.5 °C |
|---|
Names
| Name | 4-(Difluoromethoxy)-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 330.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6F2N2O3 |
|---|
| Molecular Weight | 204.131 |
|---|
| Flash Point | 153.4±26.5 °C |
|---|
| Exact Mass | 204.034653 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 2.12 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | FHRVMXFZUVYVPF-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(OC(F)F)cc1[N+](=O)[O-] |
|---|
Synonyms
| 4-Difluoromethoxy-2-Nitro-Aniline |
| 4-difluoromethoxy-2-nitroaniline |
| Benzenamine, 4-(difluoromethoxy)-2-nitro- |
| 2-Amino-5-diaethylamino-phenol |
| 2-amino-5-difluoromethoxynitrobenzene |
| Phenol,2-amino-5-(diethylamino) |
| 4-(Difluoromethoxy)-2-nitroaniline |
| 2-amino-5-diethylamino-phenol |