Introduction：Basic information about CAS 79324-50-8|1,1-(4-allyloxy-6-ethylamino-1,3-phenylene)diethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1-(4-allyloxy-6-ethylamino-1,3-phenylene)diethanone |
|---|
| CAS Number | 79324-50-8 | Molecular Weight | 261.31600 |
|---|
| Density | 1.086g/cm3 | Boiling Point | 437.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.2ºC |
|---|
Names
| Name | 1-[5-acetyl-2-(ethylamino)-4-prop-2-enoxyphenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.086g/cm3 |
|---|
| Boiling Point | 437.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3 |
|---|
| Molecular Weight | 261.31600 |
|---|
| Flash Point | 218.2ºC |
|---|
| Exact Mass | 261.13600 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 3.16140 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | UDLIPBKHZZWUMR-UHFFFAOYSA-N |
|---|
| SMILES | C=CCOc1cc(NCC)c(C(C)=O)cc1C(C)=O |
|---|
Synonyms
| I01-7351 |
| 1,1'-(4-(allyloxy)-6-(ethylamino)-1,3-phenylene)diethanone |
