Introduction:Basic information about CAS 476472-02-3|1-(6-methylpyridin-2-yl)-2-quinolin-4-ylethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(6-methylpyridin-2-yl)-2-quinolin-4-ylethanone |
|---|
| CAS Number | 476472-02-3 | Molecular Weight | 262.30600 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 449.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.7ºC |
|---|
Names
| Name | 1-(6-methylpyridin-2-yl)-2-quinolin-4-ylethanone |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 449.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14N2O |
|---|
| Molecular Weight | 262.30600 |
|---|
| Flash Point | 225.7ºC |
|---|
| Exact Mass | 262.11100 |
|---|
| PSA | 42.85000 |
|---|
| LogP | 3.36360 |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | RYBJNXHNLNYRDT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C(=O)Cc2ccnc3ccccc23)n1 |
|---|