Introduction:Basic information about CAS 182570-28-1|6-Methoxy-3-chromanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methoxy-3-chromanecarboxylic acid |
|---|
| CAS Number | 182570-28-1 | Molecular Weight | 208.211 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 389.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.0±21.4 °C |
|---|
Names
| Name | (3S)-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 389.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 |
|---|
| Molecular Weight | 208.211 |
|---|
| Flash Point | 156.0±21.4 °C |
|---|
| Exact Mass | 208.073563 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 1.99 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | YFYLMFXPYODSEB-QMMMGPOBSA-N |
|---|
| SMILES | COc1ccc2c(c1)CC(C(=O)O)CO2 |
|---|
Synonyms
| 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-6-methoxy-, (3S)- |
| 6-Methoxy-3-chromanecarboxylic acid |
| (3S)-6-Methoxy-3-chromanecarboxylic acid |
| 6-methoxychromane-3-carboxylic acid |
| 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-6-methoxy- |
| qc-3248 |