Introduction：Basic information about CAS 182918-16-7|4-[4,6-bis(4-phenylphenyl)-1H-1,3,5-triazin-2-ylidene]-3-hydroxycyclohexa-2,5-dien-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[4,6-bis(4-phenylphenyl)-1H-1,3,5-triazin-2-ylidene]-3-hydroxycyclohexa-2,5-dien-1-one |
|---|
| CAS Number | 182918-16-7 | Molecular Weight | 493.55500 |
|---|
| Density | / | Boiling Point | 773.296ºC at 760 mmHg |
|---|
| Molecular Formula | C33H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 421.475ºC |
|---|
Names
| Name | 4-[4,6-bis(4-phenylphenyl)-1H-1,3,5-triazin-2-ylidene]-3-hydroxycyclohexa-2,5-dien-1-one |
|---|
Chemical & Physical Properties
| Boiling Point | 773.296ºC at 760 mmHg |
|---|
| Molecular Formula | C33H23N3O2 |
|---|
| Molecular Weight | 493.55500 |
|---|
| Flash Point | 421.475ºC |
|---|
| Exact Mass | 493.17900 |
|---|
| PSA | 78.87000 |
|---|
| LogP | 6.48530 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | RLTVFGXWHJQNHK-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
|---|
