Introduction：Basic information about CAS 78245-94-0|Butanamide, 2,2-(3,3-dichloro1,1-biphenyl-4,4-diyl)bis(azo)bisN-(2,3-dihydro-2-oxo-1H, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanamide, 2,2-(3,3-dichloro1,1-biphenyl-4,4-diyl)bis(azo)bisN-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxo- |
|---|
| CAS Number | 78245-94-0 | Molecular Weight | 741.54000 |
|---|
| Density | 1.63g/cm33 | Boiling Point | 805.6ºC at 760 mmHg |
|---|
| Molecular Formula | C34H26Cl2N10O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 441ºC |
|---|
Names
| Name | 2-[[2-chloro-4-[3-chloro-4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide |
|---|
Chemical & Physical Properties
| Density | 1.63g/cm33 |
|---|
| Boiling Point | 805.6ºC at 760 mmHg |
|---|
| Molecular Formula | C34H26Cl2N10O6 |
|---|
| Molecular Weight | 741.54000 |
|---|
| Flash Point | 441ºC |
|---|
| Exact Mass | 740.14100 |
|---|
| PSA | 246.58000 |
|---|
| LogP | 8.48320 |
|---|
| Index of Refraction | 1.767 |
|---|
| InChIKey | ZDTUSRHTEVWVKX-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=Nc1ccc(-c2ccc(N=NC(C(C)=O)C(=O)Nc3ccc4[nH]c(=O)[nH]c4c3)c(Cl)c2)cc1Cl)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
|---|
