Introduction：Basic information about CAS 333717-40-1|HOTU, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | HOTU |
|---|
| CAS Number | 333717-40-1 | Molecular Weight | 386.23100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H17F6N4O3P | Melting Point | 135-137ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | [[(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxy-(dimethylamino)methylidene]-dimethylazanium,hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 135-137ºC |
|---|
| Molecular Formula | C10H17F6N4O3P |
|---|
| Molecular Weight | 386.23100 |
|---|
| Exact Mass | 386.09400 |
|---|
| PSA | 99.59000 |
|---|
| LogP | 3.59038 |
|---|
| InChIKey | RKTBAMPZUATMIO-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C#N)=NOC(N(C)C)=[N+](C)C.F[P-](F)(F)(F)(F)F |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3.0 |
|---|
Synonyms
| 6-Cyano-N,N,2-trimethyl-7-oxo-4,8-dioxa-2,5-diazadec-5-en-3-aminium hexafluorophosphate HOTU |
| (5Z)-6-Cyano-N,N,2-trimethyl-7-oxo-4,8-dioxa-2,5-diazadec-5-en-3-iminium hexafluorophosphate |
| HOTU |
| 6-Cyano-N,N,2-trimethyl-7-oxo-4,8-dioxa-2,5-diazadec-5-en-3-aminiumhexafluorophosphate |
| (5E)-6-Cyano-N,N,2-trimethyl-7-oxo-4,8-dioxa-2,5-diazadec-5-en-3-iminium hexafluorophosphate |
