Introduction:Basic information about CAS 3453-83-6|2-mesitylenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-mesitylenesulfonyl chloride |
|---|
| CAS Number | 3453-83-6 | Molecular Weight | 200.25500 |
|---|
| Density | 1.243g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H12O3S | Melting Point | 55-57 °C(lit.) |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | 2-Mesitylenesulfonic acid dihydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Melting Point | 55-57 °C(lit.) |
|---|
| Molecular Formula | C9H12O3S |
|---|
| Molecular Weight | 200.25500 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 200.05100 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 2.93930 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | LXFQSRIDYRFTJW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S22-S26-S27-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | DB8930000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00007434 |
| 2-MESITYLENESULFONYL CHLORIDE |
| Mesitylenesulfonic Acid Dihydrate |
| EINECS 212-257-8 |
| 2,4,6-Trimethylbenzenesulfonic Acid Dihydrate |
| 2,4,6-Trimethylbenzenesulfonic acid |