Introduction：Basic information about CAS 34068-01-4|3-Benzyloxy acetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Benzyloxy acetophenone |
|---|
| CAS Number | 34068-01-4 | Molecular Weight | 226.27000 |
|---|
| Density | 1.1 g/cm3 | Boiling Point | 354ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | 200-203 °C(lit.) |
|---|
| MSDS | / | Flash Point | 155.9ºC |
|---|
Names
| Name | 1-(3-phenylmethoxyphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1 g/cm3 |
|---|
| Boiling Point | 354ºC at 760 mmHg |
|---|
| Melting Point | 200-203 °C(lit.) |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 155.9ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.46820 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | FGQMEAWGAUALJQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cccc(OCc2ccccc2)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2914509090 |
|---|
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 251-816-0 |
| 1-(3-(Benzyloxy)phenyl)ethanone |
| MFCD06797452 |
| 3-Benzyloxy acetophenone |
| m-benzyloxyacetophenone |
| 3′-Benzyloxyacetophenone |
| 3-Benzyloxyacetophenone |
| 3'-BENZYLOXYACETOPHENONE |
