Introduction：Basic information about CAS 341-58-2|2,2'-Bis(trifluoromethyl)-4,4'-biphenyldiamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-Bis(trifluoromethyl)-4,4'-biphenyldiamine |
|---|
| CAS Number | 341-58-2 | Molecular Weight | 320.233 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 376.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10F6N2 | Melting Point | 183 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 171.4±18.6 °C |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 376.9±42.0 °C at 760 mmHg |
|---|
| Melting Point | 183 °C |
|---|
| Molecular Formula | C14H10F6N2 |
|---|
| Molecular Weight | 320.233 |
|---|
| Flash Point | 171.4±18.6 °C |
|---|
| Exact Mass | 320.074829 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 5.27 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | NVKGJHAQGWCWDI-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(-c2ccc(N)cc2C(F)(F)F)c(C(F)(F)F)c1 |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H319 |
|---|
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | T: Toxic;Xi: Irritant; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S22-S36/37/39-S45 |
|---|
| RIDADR | 2811 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,2'-Bis(trifluoromethyl)-4,4'-biphenyldiamine |
| [1,1'-Biphenyl]-4,4'-diamine, 2,2'-bis(trifluoromethyl)- |
| 2,2'-BIPYRIDYL-6,6'-DICARBALDEHYDE |
| 2,2‘-Bis(trifluoromethyl)benzidine |
| 2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-diamine |
| 2,2'-Bis-trifluoromethyl-biphenyl-4,4'-diamine |
| 2,2'-Bis(trifluoromethyl)biphenyl-4,4'-diamine |
| 2,2′-Bis(trifluoromethyl)benzidine |
| 4,4'-Diamino-2,2'-bis(trifluoromethyl)biphenyl |
| MFCD00190155 |
| 4'-Amino-2,2'-bis(trifluoromethyl)[1,1'-biphenyl]-4-ylamine |
| 2,2'-Bis(trifluoromethyl)benzidine |
