Introduction：Basic information about CAS 34876-10-3|3-methylbut-2-enoyl 3-methylbut-2-enoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-methylbut-2-enoyl 3-methylbut-2-enoate |
|---|
| CAS Number | 34876-10-3 | Molecular Weight | 182.216 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 278.5±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.8±15.9 °C |
|---|
Names
| Name | 3-methylbut-2-enoyl 3-methylbut-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 278.5±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14O3 |
|---|
| Molecular Weight | 182.216 |
|---|
| Flash Point | 119.8±15.9 °C |
|---|
| Exact Mass | 182.094299 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.87 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.464 |
|---|
| InChIKey | YQEIMEGRSTXEMX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=CC(=O)OC(=O)C=C(C)C |
|---|
Safety Information
Customs
| HS Code | 2916190090 |
|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| senecioic anhydride |
| Crotonic acid,anhydride |
| 3-methyl but-2-enoic anhydride |
| Bis(3,3-dimethylacrylsaeure)anhydrid |
| 1Y1&U1VOV1UY1&1 |
| 3-Methylbut-2-enoic acid anhydride |
| Crotonic acid, 3-methyl-, anhydride |
| 3,3-dimethylacrylicanhydride |
| Seneciosaeureanhydrid |
| 3-Methyl-2-butenoic anhydride |
| 3-Methyl-2-butenoic acid anhydride |
| 2-Butenoic acid, 3-methyl-, anhydride |
