CAS 63775-95-1|Cyclosporin B
Introduction：Basic information about CAS 63775-95-1|Cyclosporin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclosporin B | ||
|---|---|---|---|
| CAS Number | 63775-95-1 | Molecular Weight | 1188.585 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 1289.7±65.0 °C at 760 mmHg |
| Molecular Formula | C61H109N11O12 | Melting Point | 149-152ºC |
| MSDS | / | Flash Point | 733.8±34.3 °C |
Names
| Name | Cyclosporin B |
|---|---|
| Synonym | More Synonyms |
Cyclosporin B BiologicalActivity
| Description | Cyclosporin B is a group of nonpolar cyclic oligopeptides with immunosuppressive activity. Cyclosporin B is used for the prevention of graft rejection in organ transplantation[1]. |
|---|---|
| Related Catalog | Signaling Pathways >>Others >>OthersResearch Areas >>Inflammation/Immunology |
| References | [1]. von Wartburg A, Traber R. Cyclosporins, fungal metabolites with immunosuppressive activities. Prog Med Chem. 1988;25:1-33. |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 1289.7±65.0 °C at 760 mmHg |
| Melting Point | 149-152ºC |
| Molecular Formula | C61H109N11O12 |
| Molecular Weight | 1188.585 |
| Flash Point | 733.8±34.3 °C |
| Exact Mass | 1187.825684 |
| PSA | 278.80000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | UCOQITKXMNKTKF-MXGZYYNMSA-N |
| SMILES | CC=CCC(C)C(O)C1C(=O)NC(C)C(=O)N(C)CC(=O)N(C)C(CC(C)C)C(=O)NC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(C)C(=O)NC(C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(C(C)C)C(=O)N1C |
| Storage condition | -20°C |
Safety Information
| Hazard Codes | Xi |
|---|
Synonyms
| (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-33-[(1R,2R,4E)-1-Hydroxy-2-methylhex-4-en-1-yl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28,30-decamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| 1,4,7,10,13,16,19,22,25,28,31-Undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone, 33-[(1R,2R,4E)-1-hydroxy-2-methyl-4-hexen-1-yl]-1,4,7,10,12,15,19,25,28,30-decamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-, (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)- |
| CyclosporinB |
| Antibiotic S 7481F2 |
| Ala2-cyclosporine |
| (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-33-[(1R,2R,4E)-1-Hydroxy-2-methyl-4-hexen-1-yl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28,30-decamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| Cyclosporin Impurity 2 |
