Introduction:Basic information about CAS 342789-81-5|1-n-butyl-3-methylimidazolium methanesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-n-butyl-3-methylimidazolium methanesulfonate |
|---|
| CAS Number | 342789-81-5 | Molecular Weight | 234.316 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H18N2O3S | Melting Point | 75-80ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 119 °C |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 1-butyl-3-methylimidazol-3-ium,methanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 75-80ºC |
|---|
| Molecular Formula | C9H18N2O3S |
|---|
| Molecular Weight | 234.316 |
|---|
| Flash Point | 119 °C |
|---|
| Exact Mass | 234.103806 |
|---|
| PSA | 74.39000 |
|---|
| LogP | 1.35490 |
|---|
| InChIKey | PUHVBRXUKOGSBC-UHFFFAOYSA-M |
|---|
| SMILES | CCCCn1cc[n+](C)c1.CS(=O)(=O)[O-] |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H314 |
|---|
| Precautionary Statements | P280-P301 + P310 + P330-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 22-34-52/53 |
|---|
| Safety Phrases | 26-36/37/39-45-61 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 2 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2933290090 |
|---|
Customs
| HS Code | 2933290090 |
|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1H-Imidazolium, 1-butyl-3-methyl- methanesulfonate (1:1) |
| 1-n-butyl-3-methylimidazolium methanesulfonate |
| 1-Butyl-3-methylimidazolium methanesulfonate |
| MFCD06798173 |
| 1-Butyl-3-methyl-1H-imidazol-3-ium methanesulfonate |
| BASIONIC ST 78 |