Introduction：Basic information about CAS 188770-83-4|(S)-1-(3-NITROPHENYL)PROPAN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-1-(3-NITROPHENYL)PROPAN-1-OL |
|---|
| CAS Number | 188770-83-4 | Molecular Weight | 181.18900 |
|---|
| Density | 1.217g/cm3 | Boiling Point | 295.307ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.842ºC |
|---|
Names
| Name | (1S)-1-(3-nitrophenyl)propan-1-ol |
|---|
Chemical & Physical Properties
| Density | 1.217g/cm3 |
|---|
| Boiling Point | 295.307ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO3 |
|---|
| Molecular Weight | 181.18900 |
|---|
| Flash Point | 127.842ºC |
|---|
| Exact Mass | 181.07400 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.56140 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | LSEJDXFJBNGGBI-VIFPVBQESA-N |
|---|
| SMILES | CCC(O)c1cccc([N+](=O)[O-])c1 |
|---|
