Introduction:Basic information about CAS 79540-50-4|etobenzanid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | etobenzanid |
|---|
| CAS Number | 79540-50-4 | Molecular Weight | 340.20100 |
|---|
| Density | 1.331g/cm3 | Boiling Point | 400.568ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15Cl2NO3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 196.057ºC |
|---|
| Symbol | GHS09 | Signal Word | |
|---|
Names
| Name | etobenzanid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.331g/cm3 |
|---|
| Boiling Point | 400.568ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15Cl2NO3 |
|---|
| Molecular Weight | 340.20100 |
|---|
| Flash Point | 196.057ºC |
|---|
| Exact Mass | 339.04300 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 4.69150 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | ICWUMLXQKFTJMH-UHFFFAOYSA-N |
|---|
| SMILES | CCOCOc1ccc(C(=O)Nc2cccc(Cl)c2Cl)cc1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS09 |
|---|
| Hazard Statements | H411 |
|---|
| Precautionary Statements | P273 |
|---|
| Hazard Codes | N |
|---|
| Risk Phrases | 51/53 |
|---|
| Safety Phrases | 61 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
Synonyms
| N-(2,3-dichlorophenyl)-4-(ethoxymethoxy)benzamide |
| Etobenzanid |
| ethobenzanid |
| 2’,3’-dichloro-4-ethoxymethoxybenzanilide |
| 2',3'-Dichloro-4-ethoxymethoxybenzanilide |
| 2',3'-dichloro-4-ethoxymethoxybenzanilide |