Introduction：Basic information about CAS 925663-15-6|Methanone, (3-ethyl-5-methyl-4-isoxazolyl)(4-phenyl-1-piperazinyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)(4-phenyl-1-piperazinyl) |
|---|
| CAS Number | 925663-15-6 | Molecular Weight | 299.36800 |
|---|
| Density | 1.175g/cm3 | Boiling Point | 513.39ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.289ºC |
|---|
Names
| Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)(4-phenyl-1-piperazinyl) |
|---|
Chemical & Physical Properties
| Density | 1.175g/cm3 |
|---|
| Boiling Point | 513.39ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21N3O2 |
|---|
| Molecular Weight | 299.36800 |
|---|
| Flash Point | 264.289ºC |
|---|
| Exact Mass | 299.16300 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 2.51070 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | JVGLVFSTRGGPHF-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2ccccc2)CC1 |
|---|
