Introduction：Basic information about CAS 925155-72-2|Methanone, [4-(3-chlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl) |
|---|
| CAS Number | 925155-72-2 | Molecular Weight | 333.81300 |
|---|
| Density | 1.251g/cm3 | Boiling Point | 542.877ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 282.122ºC |
|---|
Names
| Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.251g/cm3 |
|---|
| Boiling Point | 542.877ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20ClN3O2 |
|---|
| Molecular Weight | 333.81300 |
|---|
| Flash Point | 282.122ºC |
|---|
| Exact Mass | 333.12400 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 3.16410 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | XGNMRRNPUNJIOT-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
|---|
