Introduction：Basic information about CAS 923872-41-7|Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-methyl-5-(1-methylethyl)-4-isoxazoly, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-methyl-5-(1-methylethyl)-4-isoxazolyl] |
|---|
| CAS Number | 923872-41-7 | Molecular Weight | 347.83900 |
|---|
| Density | 1.224g/cm3 | Boiling Point | 539.211ºC at 760 mmHg |
|---|
| Molecular Formula | C18H22ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.905ºC |
|---|
Names
| Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-methyl-5-(1-methylethyl)-4-isoxazolyl] |
|---|
Chemical & Physical Properties
| Density | 1.224g/cm3 |
|---|
| Boiling Point | 539.211ºC at 760 mmHg |
|---|
| Molecular Formula | C18H22ClN3O2 |
|---|
| Molecular Weight | 347.83900 |
|---|
| Flash Point | 279.905ºC |
|---|
| Exact Mass | 347.14000 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 3.72510 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | KHZSBDQPRKRQTG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1noc(C(C)C)c1C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
|---|
