Introduction:Basic information about CAS 923736-75-8|Methanone, [4-(2,3-dimethylphenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(2,3-dimethylphenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl) |
|---|
| CAS Number | 923736-75-8 | Molecular Weight | 327.42100 |
|---|
| Density | 1.139g/cm3 | Boiling Point | 540.696ºC at 760 mmHg |
|---|
| Molecular Formula | C19H25N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280.803ºC |
|---|
Names
| Name | Methanone, [4-(2,3-dimethylphenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.139g/cm3 |
|---|
| Boiling Point | 540.696ºC at 760 mmHg |
|---|
| Molecular Formula | C19H25N3O2 |
|---|
| Molecular Weight | 327.42100 |
|---|
| Flash Point | 280.803ºC |
|---|
| Exact Mass | 327.19500 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 3.12750 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | KDGLRYOAJQCGPD-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2cccc(C)c2C)CC1 |
|---|