Introduction：Basic information about CAS 775300-07-7|Methanone, [4-(3,4-dichlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(3,4-dichlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl)- |
|---|
| CAS Number | 775300-07-7 | Molecular Weight | 368.25800 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 567.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297ºC |
|---|
Names
| Name | Methanone, [4-(3,4-dichlorophenyl)-1-piperazinyl](3-ethyl-5-methyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 567.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19Cl2N3O2 |
|---|
| Molecular Weight | 368.25800 |
|---|
| Flash Point | 297ºC |
|---|
| Exact Mass | 367.08500 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 3.81750 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | NODKQAZYGGJHEL-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
|---|
