Introduction:Basic information about CAS 335649-84-8|1H-Indole-1-carboxylic acid, 2-borono-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]meth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-1-carboxylic acid, 2-borono-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-, 1,1-dimethylethyl ester |
|---|
| CAS Number | 335649-84-8 | Molecular Weight | 405.36800 |
|---|
| Density | 1.064g/cm3 | Boiling Point | 514.347ºC at 760 mmHg |
|---|
| Molecular Formula | C20H32BNO5Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.868ºC |
|---|
Names
| Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.064g/cm3 |
|---|
| Boiling Point | 514.347ºC at 760 mmHg |
|---|
| Molecular Formula | C20H32BNO5Si |
|---|
| Molecular Weight | 405.36800 |
|---|
| Flash Point | 264.868ºC |
|---|
| Exact Mass | 405.21400 |
|---|
| PSA | 80.92000 |
|---|
| LogP | 3.62610 |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | ORAIDUCDXBCMJG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)n1c(B(O)O)cc2cc(CO[Si](C)(C)C(C)(C)C)ccc21 |
|---|
Synonyms
| 5-(tert-butyldimethylsiloxy)pent-1-yn-3-ol |
| 5-(tert-butyldimethylsilyloxy)pent-1-yn-3-ol |
| 5-(tert-butyldimethylsilanyloxy)pent-1-yn-3-ol |
| 1-Pentyn-3-ol,5-[[(1,1-dimethylethyl)dimethylsilyl]oxy] |
| 5-<<(1,1-Dimethylethyl)dimethylsilyl>oxy>-1-pentyn-3-ol |
| indole-2-boronic acid-5-(tert-butyl-dimethyl-silanyloxymethyl)-indole-1-carboxylic acid tert-butyl ester |
| 2-boronic acid-5-(tert-butyldimethylsilanyloxymethyl)indole-1-carboxylic acid tert-butyl ester |
| [1-(tert-butoxycarbonyl)-5-({[tert-butyl(dimethyl)silyl]oxy}methyl)-1H-indol-2-yl]boronic acid |
| 5-(tert-butyldimethylsilanyloxymethyl)-1H-indole-2-boronic acid 1-carboxylic acid tert-butyl ester |