Introduction：Basic information about CAS 182483-97-2|2-chloro-6-oxo-1H-pyridine-4-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-6-oxo-1H-pyridine-4-carboxamide |
|---|
| CAS Number | 182483-97-2 | Molecular Weight | 172.56900 |
|---|
| Density | 1.544g/cm3 | Boiling Point | 409.9ºC at 760mmHg |
|---|
| Molecular Formula | C6H5ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.7ºC |
|---|
Names
| Name | 2-chloro-6-oxo-1H-pyridine-4-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.544g/cm3 |
|---|
| Boiling Point | 409.9ºC at 760mmHg |
|---|
| Molecular Formula | C6H5ClN2O2 |
|---|
| Molecular Weight | 172.56900 |
|---|
| Flash Point | 201.7ºC |
|---|
| Exact Mass | 172.00400 |
|---|
| PSA | 76.21000 |
|---|
| LogP | 1.23980 |
|---|
| Vapour Pressure | 2.64E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | WVGAIBCNLHQTSH-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1cc(Cl)[nH]c(=O)c1 |
|---|
Synonyms
| 2-Hydroxy-6-chloropyridine-4-carboxamide |
| 4-Pyridinecarboxamide,2-chloro-6-hydroxy |
| 2-Chloro-6-hydroxyisonicotinamide |
