Introduction:Basic information about CAS 18549-40-1|1,2-O-Isopropylidene-a-D-glucofuranose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-O-Isopropylidene-a-D-glucofuranose |
|---|
| CAS Number | 18549-40-1 | Molecular Weight | 220.220 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 422.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H16O6 | Melting Point | 159-160 °C(lit.) |
|---|
| MSDS | / | Flash Point | 209.3±27.3 °C |
|---|
Names
| Name | 1,2-O-Isopropylidene-D-glucofuranose |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 422.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 159-160 °C(lit.) |
|---|
| Molecular Formula | C9H16O6 |
|---|
| Molecular Weight | 220.220 |
|---|
| Flash Point | 209.3±27.3 °C |
|---|
| Exact Mass | 220.094681 |
|---|
| PSA | 88.38000 |
|---|
| LogP | -0.17 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | BGGCXQKYCBBHAH-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC2OC(C(O)CO)C(O)C2O1 |
|---|
| Storage condition | 2~8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| α-D-Glucofuranose, 1,2-O-(1-methylethylidene)- |
| 1,2-O-Isopropylidene-α-D-glucofuranose |
| α-D-Glucofuranose, 1,2-O- (1-methylethylidene)- |
| 1,2-O-Isopropylidene-alpha-D-glucofuranose |
| EINECS 242-420-9 |
| MFCD00063244 |
| Acetone-D-Glucose |
| 1,2-O-Isopropylidene-a-D-glucofuranose |
| Glucofuranose,1,2-O-isopropylidene |
| 1,2-O-Isopropylidene-d-Glucofuranose |
| 1,2-Diisopropylidene-D-glucose |
| 1,2-O-Isopropyliden--D-glucofuranose |
| Monoacetone glucose |