Introduction：Basic information about CAS 65962-15-4|1-(dibromomethyl)-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(dibromomethyl)-2-nitrobenzene |
|---|
| CAS Number | 65962-15-4 | Molecular Weight | 294.92800 |
|---|
| Density | 2.038g/cm3 | Boiling Point | 346.835ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Br2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.56ºC |
|---|
Names
| Name | 1-(dibromomethyl)-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.038g/cm3 |
|---|
| Boiling Point | 346.835ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Br2NO2 |
|---|
| Molecular Weight | 294.92800 |
|---|
| Flash Point | 163.56ºC |
|---|
| Exact Mass | 292.86900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.90640 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | HETXONIWLNSRGY-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1C(Br)Br |
|---|
Synonyms
| 3-Nitro-o-dibromomethyl benzene |
| 1-Dibrommethyl-2-nitro-benzol |
| (2,3-Bisbromomethyl)nitrobenzene |
| o-nitrobenzal bromide |
| 1-dibromomethyl-2-nitro-benzene |
