Introduction：Basic information about CAS 18878-17-6|1-Acetyl-3-(acetyloxy)-7-chloro-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Acetyl-3-(acetyloxy)-7-chloro-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|---|
| CAS Number | 18878-17-6 | Molecular Weight | 405.23100 |
|---|
| Density | 1.42 | Boiling Point | 533.8ºC at 760mmHg |
|---|
| Molecular Formula | C19H14Cl2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.7ºC |
|---|
Names
| Name | 1-Acetyl-3-(acetyloxy)-7-chloro-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|---|
Chemical & Physical Properties
| Density | 1.42 |
|---|
| Boiling Point | 533.8ºC at 760mmHg |
|---|
| Molecular Formula | C19H14Cl2N2O4 |
|---|
| Molecular Weight | 405.23100 |
|---|
| Flash Point | 276.7ºC |
|---|
| Exact Mass | 404.03300 |
|---|
| PSA | 76.04000 |
|---|
| LogP | 3.11370 |
|---|
| Vapour Pressure | 2.04E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | YDFQQMIIYCLLNJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OC1N=C(c2ccccc2Cl)c2cc(Cl)ccc2N(C(C)=O)C1=O |
|---|
