Introduction：Basic information about CAS 7488-92-8|Ketocainol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ketocainol |
|---|
| CAS Number | 7488-92-8 | Molecular Weight | 293.44400 |
|---|
| Density | 0.977g/cm3 | Boiling Point | 354.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.1ºC |
|---|
Names
| Name | Ketocainol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.977g/cm3 |
|---|
| Boiling Point | 354.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31NO2 |
|---|
| Molecular Weight | 293.44400 |
|---|
| Flash Point | 168.1ºC |
|---|
| Exact Mass | 293.23500 |
|---|
| PSA | 32.70000 |
|---|
| LogP | 4.01770 |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | DBQHPYODCJJUAP-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(O)c1ccccc1OCCN(C(C)C)C(C)C |
|---|
Synonyms
| 1-(N-Diisopropylamino-aethoxyphenyl)-butan-1-ol |
| 1-(2-Diisopropylamino-ethoxy)-2-(1-hydroxy-butyl)-benzol |
| Rec-7-0544 |
