Introduction:Basic information about CAS 58757-61-2|Trimexiline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trimexiline |
|---|
| CAS Number | 58757-61-2 | Molecular Weight | 247.41900 |
|---|
| Density | 0.885g/cm3 | Boiling Point | 340.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H29N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137ºC |
|---|
Names
| Name | Trimexiline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.885g/cm3 |
|---|
| Boiling Point | 340.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H29N |
|---|
| Molecular Weight | 247.41900 |
|---|
| Flash Point | 137ºC |
|---|
| Exact Mass | 247.23000 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 5.06110 |
|---|
| Index of Refraction | 1.496 |
|---|
| InChIKey | ZLVOFPSPMOLPJY-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCC(C)NCc1c(C)cc(C)cc1C |
|---|
Synonyms
| Unii-huh663dn8f |
| (-)-2,4,6-Trimethyl-N-(1-methylhexyl)benzylamine |
| Trimexilinum |
| Trimexilina |