CAS 335-99-9|2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol
Introduction:Basic information about CAS 335-99-9|2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol | ||
|---|---|---|---|
| CAS Number | 335-99-9 | Molecular Weight | 332.087 |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 163.3±40.0 °C at 760 mmHg |
| Molecular Formula | C7H4F12O | Melting Point | -20°C |
| MSDS | / | Flash Point | 52.5±27.3 °C |
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-ol |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 163.3±40.0 °C at 760 mmHg |
| Melting Point | -20°C |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.087 |
| Flash Point | 52.5±27.3 °C |
| Exact Mass | 332.007050 |
| PSA | 20.23000 |
| LogP | 3.58 |
| Vapour Pressure | 0.7±0.7 mmHg at 25°C |
| Index of Refraction | 1.291 |
| InChIKey | BYKNGMLDSIEFFG-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RTECS | MJ4500000 |
| HS Code | 2905590090 |
Customs
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
Synonyms
| 1H,1H,7H-Dodecafluoro-1-heptanol |
| 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-ol |
| MFCD00039630 |
| 1,1,7-Trihydrododecafluoroheptan-1-ol |
| EINECS 206-406-6 |
| 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanol |
| 1,1,7-Trihydroperfluoroheptanol |
| 1h,1h,7h-dodecafluoroheptanol |
| 1H,1H,7H-Perfluoroheptan-1-ol |
| 7,7,6,6,5,5,4,4,3,3,2,2-Dodecafluoroheptanol |
| 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol |
| 1-Heptanol,2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro |
| 1-Heptanol, 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro- |
| 1,1,7-Trihydrododecafluoroheptanol |
