Introduction：Basic information about CAS 336-62-9|ethyl heptafluorobutyrylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl heptafluorobutyrylacetate |
|---|
| CAS Number | 336-62-9 | Molecular Weight | 284.12800 |
|---|
| Density | 1.424g/cm3 | Boiling Point | 170.1ºC at 760mmHg |
|---|
| Molecular Formula | C8H7F7O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 55.6ºC |
|---|
Names
| Name | ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxohexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.424g/cm3 |
|---|
| Boiling Point | 170.1ºC at 760mmHg |
|---|
| Molecular Formula | C8H7F7O3 |
|---|
| Molecular Weight | 284.12800 |
|---|
| Flash Point | 55.6ºC |
|---|
| Exact Mass | 284.02800 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.34160 |
|---|
| Index of Refraction | 1.36 |
|---|
| InChIKey | CMGCMFZWEPCGSQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|
| Risk Phrases | R10;R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 1993 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Ethyl heptafluorobutyrylacetate |
| ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoate |
| Ethyl 2H,2H-perfluoro-3-oxohexanoate |
| MFCD00015326 |
| Ethyl heptafluorobutanoylacetate |
| PC3242 |
| 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoic acid ethyl ester |
| 4,4,5,5,6,6,6-Heptafluor-3-oxo-hexansaeure-aethylester |
