Introduction：Basic information about CAS 183800-94-4|(2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde |
|---|
| CAS Number | 183800-94-4 | Molecular Weight | 216.157 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 264.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.5±20.8 °C |
|---|
Names
| Name | 4-(trifluoromethoxy)cinnamic aldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 264.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F3O2 |
|---|
| Molecular Weight | 216.157 |
|---|
| Flash Point | 110.5±20.8 °C |
|---|
| Exact Mass | 216.039810 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.10 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.500 |
|---|
| InChIKey | GGNLWQJCNHVNJG-OWOJBTEDSA-N |
|---|
| SMILES | O=CC=Cc1ccc(OC(F)(F)F)cc1 |
|---|
Synonyms
| trans-4-(trifluoromethoxy)cinnamaldehyde |
| (2E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl chloride |
| 4-trifluoromethoxycinnamoyl chloride |
| 3-(4-trifluoromethoxyphenyl)propenal |
| (2E)-3-[4-(Trifluoromethoxy)phenyl]acrylaldehyde |
| 2-Propenal, 3-[4-(trifluoromethoxy)phenyl]-, (2E)- |
| 3-[4-(Trifluoromethoxy)phenyl]acryloyl chloride |
