Introduction：Basic information about CAS 63857-85-2|5-(4-Chlorophenyl)-3H-1,3,4-thiadiazole-2-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Chlorophenyl)-3H-1,3,4-thiadiazole-2-thione |
|---|
| CAS Number | 63857-85-2 | Molecular Weight | 228.72200 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 326.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H5ClN2S2 | Melting Point | 205-208℃ |
|---|
| MSDS | / | Flash Point | 151.2ºC |
|---|
Names
| Name | 5-(4-Chlorophenyl)-1,3,4-thiadiazole-2-thiol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 326.4ºC at 760mmHg |
|---|
| Melting Point | 205-208℃ |
|---|
| Molecular Formula | C8H5ClN2S2 |
|---|
| Molecular Weight | 228.72200 |
|---|
| Flash Point | 151.2ºC |
|---|
| Exact Mass | 227.95800 |
|---|
| PSA | 89.01000 |
|---|
| LogP | 3.52110 |
|---|
| Index of Refraction | 1.759 |
|---|
| InChIKey | NGMTZWFKSLNRMT-UHFFFAOYSA-N |
|---|
| SMILES | S=c1[nH]nc(-c2ccc(Cl)cc2)s1 |
|---|
Synonyms
| 5-(4-chlorophenyl)-3H-1,3,4-thiadiazole-2-thione |
