Introduction:Basic information about CAS 4993-87-7|5-nitro-2-phenyl-1H-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-nitro-2-phenyl-1H-indole |
|---|
| CAS Number | 4993-87-7 | Molecular Weight | 238.24100 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 477.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.6ºC |
|---|
Names
| Name | 5-nitro-2-phenyl-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 477.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O2 |
|---|
| Molecular Weight | 238.24100 |
|---|
| Flash Point | 242.6ºC |
|---|
| Exact Mass | 238.07400 |
|---|
| PSA | 61.61000 |
|---|
| LogP | 4.26630 |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | UNJRQDPTLDVHOR-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2[nH]c(-c3ccccc3)cc2c1 |
|---|
Synonyms
| INF-55 |
| 5-nitro-2-phenylindole |
| 2-phenyl-5-nitro-1H-indole |
| 2-Phenyl-6-nitroindol |
| 2-phenyl-5-nitroindole |