Introduction：Basic information about CAS 6324-51-2|2-amino-5-chloro-3-nitro-benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-amino-5-chloro-3-nitro-benzoic acid |
|---|
| CAS Number | 6324-51-2 | Molecular Weight | 216.57900 |
|---|
| Density | 1.691g/cm3 | Boiling Point | 400.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.9ºC |
|---|
Names
| Name | 2-amino-5-chloro-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.691g/cm3 |
|---|
| Boiling Point | 400.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClN2O4 |
|---|
| Molecular Weight | 216.57900 |
|---|
| Flash Point | 195.9ºC |
|---|
| Exact Mass | 215.99400 |
|---|
| PSA | 109.14000 |
|---|
| LogP | 2.63300 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | BKTMGBPFFCRHST-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(C(=O)O)cc(Cl)cc1[N+](=O)[O-] |
|---|
Synonyms
| 5-Chloro-3-nitroanthranilic acid |
| 2-Amino-5-chlor-3-nitro-benzoesaeure |
| 2-amino-5-chloro-3-nitro-benzoic acid |
