Introduction：Basic information about CAS 97171-79-4|Zirconium oxide dimethacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zirconium oxide dimethacrylate |
|---|
| CAS Number | 97171-79-4 | Molecular Weight | 261.38700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H10O4Zr | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Zirconium oxide dimethacrylate |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H10O4Zr |
|---|
| Molecular Weight | 261.38700 |
|---|
| Exact Mass | 259.96300 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.14000 |
|---|
| InChIKey | RFAUGNILVFBGGF-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.[Zr] |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
