Introduction：Basic information about CAS 97749-24-1|5-fluoro-D-tryptophan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-fluoro-D-tryptophan |
|---|
| CAS Number | 97749-24-1 | Molecular Weight | 222.216 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 450.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.4±28.7 °C |
|---|
Names
| Name | (2R)-2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 450.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11FN2O2 |
|---|
| Molecular Weight | 222.216 |
|---|
| Flash Point | 226.4±28.7 °C |
|---|
| Exact Mass | 222.080460 |
|---|
| PSA | 79.11000 |
|---|
| LogP | 1.17 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | INPQIVHQSQUEAJ-SECBINFHSA-N |
|---|
| SMILES | NC(Cc1c[nH]c2ccc(F)cc12)C(=O)O |
|---|
Synonyms
| (R)-2-AMINO-3-(5-FLUORO-1H-INDOL-3-YL)-PROPIONIC ACID |
| D-Tryptophan,5-fluoro |
| 5-Fluorotryptophan |
| F-6835 |
| Tryptophan, 5-fluoro- |
| 5-fluoro-d-tryptophan |
